C64H72 — CID 162426419
5,6,11,12-tetrakis(4-tert-butylphenyl)-2,8-di(propan-2-yl)tetracene (PubChem CID 162426419) has the molecular formula C64H72 and a molecular weight of 841.28 g/mol. Its IUPAC name is 5,6,11,12-tetrakis(4-tert-butylphenyl)-2,8-di(propan-2-yl)tetracene.
| Compound Name | 5,6,11,12-tetrakis(4-tert-butylphenyl)-2,8-di(propan-2-yl)tetracene |
|---|---|
| PubChem CID | 162426419 |
| Molecular Formula | C64H72 |
| Molecular Weight | 841.28 g/mol |
| Exact Mass | 840.56 |
| IUPAC Name | 5,6,11,12-tetrakis(4-tert-butylphenyl)-2,8-di(propan-2-yl)tetracene |
| SMILES | CC(C)c1ccc2c(-c3ccc(C(C)(C)C)cc3)c3c(-c4ccc(C(C)(C)C)cc4)c4cc(C(C)C)ccc4c(-c4ccc(C(C)(C)C)cc4)c3c(-c3ccc(C(C)(C)C)cc3)c2c1 |
| InChI | InChI=1S/C64H72/c1-39(2)45-25-35-51-53(37-45)57(43-21-31-49(32-22-43)63(11,12)13)59-56(42-19-29-48(30-20-42)62(8,9)10)52-36-26-46(40(3)4)38-54(52)58(44-23-33-50(34-24-44)64(14,15)16)60(59)55(51)41-17-27-47(28-18-41)61(5,6)7/h17-40H,1-16H3 |
| InChIKey | VFBLGHCAMUCWAQ-UHFFFAOYSA-N |
| XLogP | 19.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.28 |
| LogP ≤ 5 | 19.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|