C52H48 — CID 162426493
12-(4-tert-butylphenyl)-2,3,8-trimethyl-5,11-diphenyl-6-(4-propan-2-ylphenyl)tetracene (PubChem CID 162426493) has the molecular formula C52H48 and a molecular weight of 672.96 g/mol. Its IUPAC name is 12-(4-tert-butylphenyl)-2,3,8-trimethyl-5,11-diphenyl-6-(4-propan-2-ylphenyl)tetracene.
| Compound Name | 12-(4-tert-butylphenyl)-2,3,8-trimethyl-5,11-diphenyl-6-(4-propan-2-ylphenyl)tetracene |
|---|---|
| PubChem CID | 162426493 |
| Molecular Formula | C52H48 |
| Molecular Weight | 672.96 g/mol |
| Exact Mass | 672.38 |
| IUPAC Name | 12-(4-tert-butylphenyl)-2,3,8-trimethyl-5,11-diphenyl-6-(4-propan-2-ylphenyl)tetracene |
| SMILES | Cc1ccc2c(-c3ccccc3)c3c(-c4ccc(C(C)(C)C)cc4)c4cc(C)c(C)cc4c(-c4ccccc4)c3c(-c3ccc(C(C)C)cc3)c2c1 |
| InChI | InChI=1S/C52H48/c1-32(2)36-20-22-39(23-21-36)48-43-29-33(3)19-28-42(43)46(37-15-11-9-12-16-37)50-49(40-24-26-41(27-25-40)52(6,7)8)45-31-35(5)34(4)30-44(45)47(51(48)50)38-17-13-10-14-18-38/h9-32H,1-8H3 |
| InChIKey | HFYGORGJAXLDKN-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.96 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|