C40H50 — CID 144640372
2,6-ditert-butyl-9,10-bis(4-methylphenyl)anthracene;ethane (PubChem CID 144640372) has the molecular formula C40H50 and a molecular weight of 530.84 g/mol. Its IUPAC name is 2,6-ditert-butyl-9,10-bis(4-methylphenyl)anthracene;ethane.
| Compound Name | 2,6-ditert-butyl-9,10-bis(4-methylphenyl)anthracene;ethane |
|---|---|
| PubChem CID | 144640372 |
| Molecular Formula | C40H50 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | 2,6-ditert-butyl-9,10-bis(4-methylphenyl)anthracene;ethane |
| SMILES | CC.CC.Cc1ccc(-c2c3ccc(C(C)(C)C)cc3c(-c3ccc(C)cc3)c3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C36H38.2C2H6/c1-23-9-13-25(14-10-23)33-29-19-17-28(36(6,7)8)22-32(29)34(26-15-11-24(2)12-16-26)30-20-18-27(21-31(30)33)35(3,4)5;2*1-2/h9-22H,1-8H3;2*1-2H3 |
| InChIKey | FOJKFSWFLHJEQS-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|