C24H18N2+2 — CID 72766780
5,10-diphenylphenazine-5,10-diium (PubChem CID 72766780) has the molecular formula C24H18N2+2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5,10-diphenylphenazine-5,10-diium.
| Compound Name | 5,10-diphenylphenazine-5,10-diium |
|---|---|
| PubChem CID | 72766780 |
| Molecular Formula | C24H18N2+2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 5,10-diphenylphenazine-5,10-diium |
| SMILES | c1ccc(-[n+]2c3ccccc3[n+](-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H18N2/c1-3-11-19(12-4-1)25-21-15-7-9-17-23(21)26(20-13-5-2-6-14-20)24-18-10-8-16-22(24)25/h1-18H/q+2 |
| InChIKey | WHMFCLLRELRFND-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|