C14H12ClNS — CID 159728385
2-methyl-3-phenyl-1,3-benzothiazol-3-ium chloride (PubChem CID 159728385) has the molecular formula C14H12ClNS and a molecular weight of 261.78 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,3-benzothiazol-3-ium chloride.
| Compound Name | 2-methyl-3-phenyl-1,3-benzothiazol-3-ium chloride |
|---|---|
| PubChem CID | 159728385 |
| Molecular Formula | C14H12ClNS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-methyl-3-phenyl-1,3-benzothiazol-3-ium chloride |
| SMILES | Cc1sc2ccccc2[n+]1-c1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H12NS.ClH/c1-11-15(12-7-3-2-4-8-12)13-9-5-6-10-14(13)16-11;/h2-10H,1H3;1H/q+1;/p-1 |
| InChIKey | NAXOJBJGLGKWBB-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|