C11H14INOS — CID 45379286
3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propan-1-ol iodide (PubChem CID 45379286) has the molecular formula C11H14INOS and a molecular weight of 335.21 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propan-1-ol iodide.
| Compound Name | 3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propan-1-ol iodide |
|---|---|
| PubChem CID | 45379286 |
| Molecular Formula | C11H14INOS |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propan-1-ol iodide |
| SMILES | Cc1sc2ccccc2[n+]1CCCO.[I-] |
| InChI | InChI=1S/C11H14NOS.HI/c1-9-12(7-4-8-13)10-5-2-3-6-11(10)14-9;/h2-3,5-6,13H,4,7-8H2,1H3;1H/q+1;/p-1 |
| InChIKey | HHJAGDSOWIWPDJ-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|