About N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline
N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline (PubChem CID 20615902) has the molecular formula C22H31N2SSi+
and a molecular weight of 383.66 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline.
Molecular Properties
| Compound Name | N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline |
| PubChem CID | 20615902 |
| Molecular Formula | C22H31N2SSi+ |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline |
| SMILES | Cc1sc2ccccc2[n+]1CCCN(c1ccccc1)C(C)[Si](C)(C)C |
| InChI | InChI=1S/C22H31N2SSi/c1-18-23(21-14-9-10-15-22(21)25-18)16-11-17-24(19(2)26(3,4)5)20-12-7-6-8-13-20/h6-10,12-15,19H,11,16-17H2,1-5H3/q+1 |
| InChIKey | ITASSLRLYYDFPU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline?
The IUPAC name of N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline (CID 20615902) is N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline.
What is the SMILES notation for N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline?
The canonical SMILES for N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline is Cc1sc2ccccc2[n+]1CCCN(c1ccccc1)C(C)[Si](C)(C)C.
What is the InChIKey of N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline?
The InChIKey is ITASSLRLYYDFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N2SSi/c1-18-23(21-14-9-10-15-22(21)25-18)16-11-17-24(19(2)26(3,4)5)20-12-7-6-8-13-20/h6-10,12-15,19H,11,16-17H2,1-5H3/q+1.
What are the key properties of N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline?
N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline has a molecular weight of 383.66 g/mol, XLogP of 5.66, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline is sourced from PubChem (CID 20615902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).