C22H31N2SSi+ — CID 20615902
N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline (PubChem CID 20615902) has the molecular formula C22H31N2SSi+ and a molecular weight of 383.66 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline.
| Compound Name | N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline |
|---|---|
| PubChem CID | 20615902 |
| Molecular Formula | C22H31N2SSi+ |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]-N-(1-trimethylsilylethyl)aniline |
| SMILES | Cc1sc2ccccc2[n+]1CCCN(c1ccccc1)C(C)[Si](C)(C)C |
| InChI | InChI=1S/C22H31N2SSi/c1-18-23(21-14-9-10-15-22(21)25-18)16-11-17-24(19(2)26(3,4)5)20-12-7-6-8-13-20/h6-10,12-15,19H,11,16-17H2,1-5H3/q+1 |
| InChIKey | ITASSLRLYYDFPU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|