C18H23N3S+2 — CID 102531222
N,N-dimethyl-1-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]pyridin-1-ium-4-amine (PubChem CID 102531222) has the molecular formula C18H23N3S+2 and a molecular weight of 313.47 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]pyridin-1-ium-4-amine.
| Compound Name | N,N-dimethyl-1-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]pyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 102531222 |
| Molecular Formula | C18H23N3S+2 |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N,N-dimethyl-1-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyl]pyridin-1-ium-4-amine |
| SMILES | Cc1sc2ccccc2[n+]1CCC[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H23N3S/c1-15-21(17-7-4-5-8-18(17)22-15)12-6-11-20-13-9-16(10-14-20)19(2)3/h4-5,7-10,13-14H,6,11-12H2,1-3H3/q+2 |
| InChIKey | OOGZKXRXWCVETG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|