C14H19I2NS — CID 170900412
3-(6-iodohexyl)-2-methyl-1,3-benzothiazol-3-ium iodide (PubChem CID 170900412) has the molecular formula C14H19I2NS and a molecular weight of 487.19 g/mol. Its IUPAC name is 3-(6-iodohexyl)-2-methyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 3-(6-iodohexyl)-2-methyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 170900412 |
| Molecular Formula | C14H19I2NS |
| Molecular Weight | 487.19 g/mol |
| Exact Mass | 486.93 |
| IUPAC Name | 3-(6-iodohexyl)-2-methyl-1,3-benzothiazol-3-ium iodide |
| SMILES | Cc1sc2ccccc2[n+]1CCCCCCI.[I-] |
| InChI | InChI=1S/C14H19INS.HI/c1-12-16(11-7-3-2-6-10-15)13-8-4-5-9-14(13)17-12;/h4-5,8-9H,2-3,6-7,10-11H2,1H3;1H/q+1;/p-1 |
| InChIKey | PIEAIDDSHAMBQT-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|