C17H18N3O2S2+ — CID 56999169
4-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyldiazenyl]benzenesulfinic acid (PubChem CID 56999169) has the molecular formula C17H18N3O2S2+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyldiazenyl]benzenesulfinic acid.
| Compound Name | 4-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyldiazenyl]benzenesulfinic acid |
|---|---|
| PubChem CID | 56999169 |
| Molecular Formula | C17H18N3O2S2+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[3-(2-methyl-1,3-benzothiazol-3-ium-3-yl)propyldiazenyl]benzenesulfinic acid |
| SMILES | Cc1sc2ccccc2[n+]1CCC/N=N/c1ccc(S(=O)O)cc1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-13-20(16-5-2-3-6-17(16)23-13)12-4-11-18-19-14-7-9-15(10-8-14)24(21)22/h2-3,5-10H,4,11-12H2,1H3/p+1/b19-18+ |
| InChIKey | VKROPDLURDVABZ-VHEBQXMUSA-O |
| XLogP | 4.25 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|