C13H16NOS+ — CID 793062
3-ethyl-2-[(E)-2-methoxyprop-1-enyl]-1,3-benzothiazol-3-ium (PubChem CID 793062) has the molecular formula C13H16NOS+ and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-ethyl-2-[(E)-2-methoxyprop-1-enyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(E)-2-methoxyprop-1-enyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 793062 |
| Molecular Formula | C13H16NOS+ |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-ethyl-2-[(E)-2-methoxyprop-1-enyl]-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C(\C)OC)sc2ccccc21 |
| InChI | InChI=1S/C13H16NOS/c1-4-14-11-7-5-6-8-12(11)16-13(14)9-10(2)15-3/h5-9H,4H2,1-3H3/q+1/b10-9+ |
| InChIKey | UHGQTUUQYDBKSJ-MDZDMXLPSA-N |
| XLogP | 3.22 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|