C18H18NO2S+ — CID 118556172
2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol (PubChem CID 118556172) has the molecular formula C18H18NO2S+ and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol.
| Compound Name | 2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 118556172 |
| Molecular Formula | C18H18NO2S+ |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-5-methoxyphenol |
| SMILES | CC[n+]1c(/C=C/c2ccc(OC)cc2O)sc2ccccc21 |
| InChI | InChI=1S/C18H17NO2S/c1-3-19-15-6-4-5-7-17(15)22-18(19)11-9-13-8-10-14(21-2)12-16(13)20/h4-12H,3H2,1-2H3/p+1 |
| InChIKey | QFVDIUMYGWBKLL-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|