C17H16NO2S+ — CID 59595404
5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]benzene-1,3-diol (PubChem CID 59595404) has the molecular formula C17H16NO2S+ and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 59595404 |
| Molecular Formula | C17H16NO2S+ |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]benzene-1,3-diol |
| SMILES | CC[n+]1c(/C=C/c2cc(O)cc(O)c2)sc2ccccc21 |
| InChI | InChI=1S/C17H15NO2S/c1-2-18-15-5-3-4-6-16(15)21-17(18)8-7-12-9-13(19)11-14(20)10-12/h3-11H,2H2,1H3,(H-,19,20)/p+1/b8-7+ |
| InChIKey | XXULFHWGRDHSPX-BQYQJAHWSA-O |
| XLogP | 3.79 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|