C19H15I2NS3 — CID 161189474
3-ethyl-2-[(E)-2-[5-(5-iodothiophen-2-yl)thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide (PubChem CID 161189474) has the molecular formula C19H15I2NS3 and a molecular weight of 607.35 g/mol. Its IUPAC name is 3-ethyl-2-[(E)-2-[5-(5-iodothiophen-2-yl)thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide.
| Compound Name | 3-ethyl-2-[(E)-2-[5-(5-iodothiophen-2-yl)thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 161189474 |
| Molecular Formula | C19H15I2NS3 |
| Molecular Weight | 607.35 g/mol |
| Exact Mass | 606.85 |
| IUPAC Name | 3-ethyl-2-[(E)-2-[5-(5-iodothiophen-2-yl)thiophen-2-yl]ethenyl]-1,3-benzothiazol-3-ium iodide |
| SMILES | CC[n+]1c(/C=C/c2ccc(-c3ccc(I)s3)s2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C19H15INS3.HI/c1-2-21-14-5-3-4-6-15(14)24-19(21)12-8-13-7-9-16(22-13)17-10-11-18(20)23-17;/h3-12H,2H2,1H3;1H/q+1;/p-1/b12-8+; |
| InChIKey | ISXIMYAHFLDCFB-MXZHIVQLSA-M |
| XLogP | 3.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|