C21H18NO2S2Se+ — CID 155642690
methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]thiophen-2-yl]selenophene-2-carboxylate (PubChem CID 155642690) has the molecular formula C21H18NO2S2Se+ and a molecular weight of 459.47 g/mol. Its IUPAC name is methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]thiophen-2-yl]selenophene-2-carboxylate.
| Compound Name | methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]thiophen-2-yl]selenophene-2-carboxylate |
|---|---|
| PubChem CID | 155642690 |
| Molecular Formula | C21H18NO2S2Se+ |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]thiophen-2-yl]selenophene-2-carboxylate |
| SMILES | CC[n+]1c(/C=C/c2ccc(-c3ccc(C(=O)OC)[se]3)s2)sc2ccccc21 |
| InChI | InChI=1S/C21H18NO2S2Se/c1-3-22-15-6-4-5-7-16(15)26-20(22)13-9-14-8-10-17(25-14)18-11-12-19(27-18)21(23)24-2/h4-13H,3H2,1-2H3/q+1/b13-9+ |
| InChIKey | MEAXLETURQWCNH-UKTHLTGXSA-N |
| XLogP | 4.95 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|