C20H17N2O2S3+ — CID 155642680
methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-1,3-thiazol-2-yl]thiophene-2-carboxylate (PubChem CID 155642680) has the molecular formula C20H17N2O2S3+ and a molecular weight of 413.57 g/mol. Its IUPAC name is methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-1,3-thiazol-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-1,3-thiazol-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 155642680 |
| Molecular Formula | C20H17N2O2S3+ |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | methyl 5-[5-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-1,3-thiazol-2-yl]thiophene-2-carboxylate |
| SMILES | CC[n+]1c(/C=C/c2cnc(-c3ccc(C(=O)OC)s3)s2)sc2ccccc21 |
| InChI | InChI=1S/C20H17N2O2S3/c1-3-22-14-6-4-5-7-15(14)27-18(22)11-8-13-12-21-19(25-13)16-9-10-17(26-16)20(23)24-2/h4-12H,3H2,1-2H3/q+1 |
| InChIKey | XEKDCZSKHQBVFC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|