C18H18BrNO2S — CID 118556169
4-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol bromide (PubChem CID 118556169) has the molecular formula C18H18BrNO2S and a molecular weight of 392.32 g/mol. Its IUPAC name is 4-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol bromide.
| Compound Name | 4-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol bromide |
|---|---|
| PubChem CID | 118556169 |
| Molecular Formula | C18H18BrNO2S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 4-[(E)-2-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-2-methoxyphenol bromide |
| SMILES | CC[n+]1c(/C=C/c2ccc(O)c(OC)c2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C18H17NO2S.BrH/c1-3-19-14-6-4-5-7-17(14)22-18(19)11-9-13-8-10-15(20)16(12-13)21-2;/h4-12H,3H2,1-2H3;1H |
| InChIKey | BWKQULVBTUEHKN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|