C24H23NO5S2 — CID 170838443
benzenesulfonate;2-[2-(3,4-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium (PubChem CID 170838443) has the molecular formula C24H23NO5S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is benzenesulfonate;2-[2-(3,4-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium.
| Compound Name | benzenesulfonate;2-[2-(3,4-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 170838443 |
| Molecular Formula | C24H23NO5S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | benzenesulfonate;2-[2-(3,4-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium |
| SMILES | COc1ccc(C=Cc2sc3ccccc3[n+]2C)cc1OC.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C18H18NO2S.C6H6O3S/c1-19-14-6-4-5-7-17(14)22-18(19)11-9-13-8-10-15(20-2)16(12-13)21-3;7-10(8,9)6-4-2-1-3-5-6/h4-12H,1-3H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | QSMZEFIWJWSNQF-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|