C16H17NO4S — CID 1487582
(E)-2-(3,4-dimethoxyphenyl)-N-phenylethenesulfonamide (PubChem CID 1487582) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (E)-2-(3,4-dimethoxyphenyl)-N-phenylethenesulfonamide.
| Compound Name | (E)-2-(3,4-dimethoxyphenyl)-N-phenylethenesulfonamide |
|---|---|
| PubChem CID | 1487582 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (E)-2-(3,4-dimethoxyphenyl)-N-phenylethenesulfonamide |
| SMILES | COc1ccc(/C=C/S(=O)(=O)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C16H17NO4S/c1-20-15-9-8-13(12-16(15)21-2)10-11-22(18,19)17-14-6-4-3-5-7-14/h3-12,17H,1-2H3/b11-10+ |
| InChIKey | CYEHRSHBEIDVII-ZHACJKMWSA-N |
| XLogP | 3.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |