C12H16O5S — CID 162339894
ethyl (E)-2-(3,4-dimethoxyphenyl)ethenesulfonate (PubChem CID 162339894) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is ethyl (E)-2-(3,4-dimethoxyphenyl)ethenesulfonate.
| Compound Name | ethyl (E)-2-(3,4-dimethoxyphenyl)ethenesulfonate |
|---|---|
| PubChem CID | 162339894 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | ethyl (E)-2-(3,4-dimethoxyphenyl)ethenesulfonate |
| SMILES | CCOS(=O)(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H16O5S/c1-4-17-18(13,14)8-7-10-5-6-11(15-2)12(9-10)16-3/h5-9H,4H2,1-3H3/b8-7+ |
| InChIKey | ZKOPEJSBVIORNX-BQYQJAHWSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|