C16H16O4S — CID 149234765
1,2-dimethoxy-4-[(E)-2-phenylethenyl]sulfonylbenzene (PubChem CID 149234765) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[(E)-2-phenylethenyl]sulfonylbenzene.
| Compound Name | 1,2-dimethoxy-4-[(E)-2-phenylethenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 149234765 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1,2-dimethoxy-4-[(E)-2-phenylethenyl]sulfonylbenzene |
| SMILES | COc1ccc(S(=O)(=O)/C=C/c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H16O4S/c1-19-15-9-8-14(12-16(15)20-2)21(17,18)11-10-13-6-4-3-5-7-13/h3-12H,1-2H3/b11-10+ |
| InChIKey | XKZQECWDPMYCIC-ZHACJKMWSA-N |
| XLogP | 3.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |