C23H23NO4S — CID 8802776
(E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-phenylethenesulfonamide (PubChem CID 8802776) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is (E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 8802776 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (E)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-phenylethenesulfonamide |
| SMILES | COc1cc(CNS(=O)(=O)/C=C/c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H23NO4S/c1-27-23-16-21(12-13-22(23)28-18-20-10-6-3-7-11-20)17-24-29(25,26)15-14-19-8-4-2-5-9-19/h2-16,24H,17-18H2,1H3/b15-14+ |
| InChIKey | DQTQCHXQYIZGCK-CCEZHUSRSA-N |
| XLogP | 4.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |