C25H29NO6S — CID 55639172
4-(2-methoxyethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylbenzenesulfonamide (PubChem CID 55639172) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55639172 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-3-methylbenzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)NCc2ccc(OCc3ccccc3)c(OC)c2)cc1C |
| InChI | InChI=1S/C25H29NO6S/c1-19-15-22(10-12-23(19)31-14-13-29-2)33(27,28)26-17-21-9-11-24(25(16-21)30-3)32-18-20-7-5-4-6-8-20/h4-12,15-16,26H,13-14,17-18H2,1-3H3 |
| InChIKey | KEEFNSYRERFERC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|