C20H27NO4S — CID 55639102
4-(2-methoxyethoxy)-3-methyl-N-(4-phenylbutan-2-yl)benzenesulfonamide (PubChem CID 55639102) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-3-methyl-N-(4-phenylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-3-methyl-N-(4-phenylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55639102 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-(2-methoxyethoxy)-3-methyl-N-(4-phenylbutan-2-yl)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)NC(C)CCc2ccccc2)cc1C |
| InChI | InChI=1S/C20H27NO4S/c1-16-15-19(11-12-20(16)25-14-13-24-3)26(22,23)21-17(2)9-10-18-7-5-4-6-8-18/h4-8,11-12,15,17,21H,9-10,13-14H2,1-3H3 |
| InChIKey | CQKVFNWZOXWCDP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|