C17H14ClNO2S — CID 70617496
2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl benzoate chloride (PubChem CID 70617496) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is 2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl benzoate chloride.
| Compound Name | 2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl benzoate chloride |
|---|---|
| PubChem CID | 70617496 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl benzoate chloride |
| SMILES | C[n+]1c(C=COC(=O)c2ccccc2)sc2ccccc21.[Cl-] |
| InChI | InChI=1S/C17H14NO2S.ClH/c1-18-14-9-5-6-10-15(14)21-16(18)11-12-20-17(19)13-7-3-2-4-8-13;/h2-12H,1H3;1H/q+1;/p-1 |
| InChIKey | JNSRYDYFVMTDPQ-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|