C19H18BrNOS3 — CID 54610956
2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-methylsulfanylethenyl]sulfanyl-1-phenylethanone bromide (PubChem CID 54610956) has the molecular formula C19H18BrNOS3 and a molecular weight of 452.46 g/mol. Its IUPAC name is 2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-methylsulfanylethenyl]sulfanyl-1-phenylethanone bromide.
| Compound Name | 2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-methylsulfanylethenyl]sulfanyl-1-phenylethanone bromide |
|---|---|
| PubChem CID | 54610956 |
| Molecular Formula | C19H18BrNOS3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | 2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-methylsulfanylethenyl]sulfanyl-1-phenylethanone bromide |
| SMILES | CS/C(=C\c1sc2ccccc2[n+]1C)SCC(=O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C19H18NOS3.BrH/c1-20-15-10-6-7-11-17(15)24-18(20)12-19(22-2)23-13-16(21)14-8-4-3-5-9-14;/h3-12H,13H2,1-2H3;1H/q+1;/p-1/b19-12+; |
| InChIKey | CKBCOIHAKBKPCN-NNTHFVATSA-M |
| XLogP | 2.01 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|