About S-phenacyl 4-methoxybenzenecarbothioate
S-phenacyl 4-methoxybenzenecarbothioate (PubChem CID 135051267) has the molecular formula C16H14O3S
and a molecular weight of 286.35 g/mol. Its IUPAC name is S-phenacyl 4-methoxybenzenecarbothioate.
Molecular Properties
| Compound Name | S-phenacyl 4-methoxybenzenecarbothioate |
| PubChem CID | 135051267 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | S-phenacyl 4-methoxybenzenecarbothioate |
| SMILES | COc1ccc(C(=O)SCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O3S/c1-19-14-9-7-13(8-10-14)16(18)20-11-15(17)12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | AGFMQUNLSLBCTH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenacyl 4-methoxybenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenacyl 4-methoxybenzenecarbothioate?
The IUPAC name of S-phenacyl 4-methoxybenzenecarbothioate (CID 135051267) is S-phenacyl 4-methoxybenzenecarbothioate.
What is the SMILES notation for S-phenacyl 4-methoxybenzenecarbothioate?
The canonical SMILES for S-phenacyl 4-methoxybenzenecarbothioate is COc1ccc(C(=O)SCC(=O)c2ccccc2)cc1.
What is the InChIKey of S-phenacyl 4-methoxybenzenecarbothioate?
The InChIKey is AGFMQUNLSLBCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3S/c1-19-14-9-7-13(8-10-14)16(18)20-11-15(17)12-5-3-2-4-6-12/h2-10H,11H2,1H3.
What are the key properties of S-phenacyl 4-methoxybenzenecarbothioate?
S-phenacyl 4-methoxybenzenecarbothioate has a molecular weight of 286.35 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenacyl 4-methoxybenzenecarbothioate is sourced from PubChem (CID 135051267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).