About phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide
phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide (PubChem CID 17388356) has the molecular formula C25H27BrN2O2S
and a molecular weight of 499.47 g/mol. Its IUPAC name is phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide |
| PubChem CID | 17388356 |
| Molecular Formula | C25H27BrN2O2S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide |
| SMILES | Br.C/N=C(\SCC(=O)c1ccccc1)N(Cc1ccccc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H26N2O2S.BrH/c1-26-25(30-19-24(28)22-11-7-4-8-12-22)27(17-20-9-5-3-6-10-20)18-21-13-15-23(29-2)16-14-21;/h3-16H,17-19H2,1-2H3;1H/b26-25-; |
| InChIKey | KTNFBRFECKHHAM-OQKDUQJOSA-N |
| XLogP | 5.88 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide?
The IUPAC name of phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide (CID 17388356) is phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide.
What is the SMILES notation for phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide?
The canonical SMILES for phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide is Br.C/N=C(\SCC(=O)c1ccccc1)N(Cc1ccccc1)Cc1ccc(OC)cc1.
What is the InChIKey of phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide?
The InChIKey is KTNFBRFECKHHAM-OQKDUQJOSA-N. The full InChI is InChI=1S/C25H26N2O2S.BrH/c1-26-25(30-19-24(28)22-11-7-4-8-12-22)27(17-20-9-5-3-6-10-20)18-21-13-15-23(29-2)16-14-21;/h3-16H,17-19H2,1-2H3;1H/b26-25-;.
What are the key properties of phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide?
phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide has a molecular weight of 499.47 g/mol, XLogP of 5.88, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl N-benzyl-N-[(4-methoxyphenyl)methyl]-N'-methylcarbamimidothioate;hydrobromide is sourced from PubChem (CID 17388356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).