C33H36N2O2S — CID 17256361
benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2-propan-2-ylphenyl)carbamimidothioate (PubChem CID 17256361) has the molecular formula C33H36N2O2S and a molecular weight of 524.73 g/mol. Its IUPAC name is benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2-propan-2-ylphenyl)carbamimidothioate.
| Compound Name | benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2-propan-2-ylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 17256361 |
| Molecular Formula | C33H36N2O2S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2-propan-2-ylphenyl)carbamimidothioate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccccc2C(C)C)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H36N2O2S/c1-25(2)31-12-8-9-13-32(31)34-33(38-24-28-10-6-5-7-11-28)35(22-26-14-18-29(36-3)19-15-26)23-27-16-20-30(37-4)21-17-27/h5-21,25H,22-24H2,1-4H3/b34-33- |
| InChIKey | FRSFETYTCQSHIJ-YHZPTAEISA-N |
| XLogP | 8.45 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|