C24H25ClN2O2S — CID 17256025
methyl N'-(2-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate (PubChem CID 17256025) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is methyl N'-(2-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate.
| Compound Name | methyl N'-(2-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 17256025 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl N'-(2-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccccc2Cl)SC)cc1 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-28-20-12-8-18(9-13-20)16-27(17-19-10-14-21(29-2)15-11-19)24(30-3)26-23-7-5-4-6-22(23)25/h4-15H,16-17H2,1-3H3/b26-24- |
| InChIKey | MQCPAOSILVJPHN-LCUIJRPUSA-N |
| XLogP | 6.41 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|