C30H29BrClFN2O2S — CID 17256368
benzyl N'-(3-chloro-4-fluorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide (PubChem CID 17256368) has the molecular formula C30H29BrClFN2O2S and a molecular weight of 616.00 g/mol. Its IUPAC name is benzyl N'-(3-chloro-4-fluorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide.
| Compound Name | benzyl N'-(3-chloro-4-fluorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 17256368 |
| Molecular Formula | C30H29BrClFN2O2S |
| Molecular Weight | 616.00 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | benzyl N'-(3-chloro-4-fluorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide |
| SMILES | Br.COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccc(F)c(Cl)c2)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28ClFN2O2S.BrH/c1-35-26-13-8-22(9-14-26)19-34(20-23-10-15-27(36-2)16-11-23)30(37-21-24-6-4-3-5-7-24)33-25-12-17-29(32)28(31)18-25;/h3-18H,19-21H2,1-2H3;1H/b33-30-; |
| InChIKey | DHEQARIVKRWJJT-LFYSYJDQSA-N |
| XLogP | 8.70 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.00 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|