C31H30ClIN2O3S — CID 17256118
methyl N'-(2-benzoyl-5-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide (PubChem CID 17256118) has the molecular formula C31H30ClIN2O3S and a molecular weight of 673.02 g/mol. Its IUPAC name is methyl N'-(2-benzoyl-5-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-(2-benzoyl-5-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 17256118 |
| Molecular Formula | C31H30ClIN2O3S |
| Molecular Weight | 673.02 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | methyl N'-(2-benzoyl-5-chlorophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2cc(Cl)ccc2C(=O)c2ccccc2)SC)cc1.I |
| InChI | InChI=1S/C31H29ClN2O3S.HI/c1-36-26-14-9-22(10-15-26)20-34(21-23-11-16-27(37-2)17-12-23)31(38-3)33-29-19-25(32)13-18-28(29)30(35)24-7-5-4-6-8-24;/h4-19H,20-21H2,1-3H3;1H/b33-31-; |
| InChIKey | QORXLHNRVWHYQI-HDAORCIOSA-N |
| XLogP | 8.26 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.02 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|