C26H31IN2O2S — CID 17255994
methyl N'-(2,3-dimethylphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide (PubChem CID 17255994) has the molecular formula C26H31IN2O2S and a molecular weight of 562.52 g/mol. Its IUPAC name is methyl N'-(2,3-dimethylphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-(2,3-dimethylphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 17255994 |
| Molecular Formula | C26H31IN2O2S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | methyl N'-(2,3-dimethylphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2cccc(C)c2C)SC)cc1.I |
| InChI | InChI=1S/C26H30N2O2S.HI/c1-19-7-6-8-25(20(19)2)27-26(31-5)28(17-21-9-13-23(29-3)14-10-21)18-22-11-15-24(30-4)16-12-22;/h6-16H,17-18H2,1-5H3;1H/b27-26-; |
| InChIKey | KQXVAMSTXSVSSF-JTHROIFXSA-N |
| XLogP | 6.99 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|