C27H32N2O3S — CID 17256145
ethyl N'-(2-ethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate (PubChem CID 17256145) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is ethyl N'-(2-ethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate.
| Compound Name | ethyl N'-(2-ethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate |
|---|---|
| PubChem CID | 17256145 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | ethyl N'-(2-ethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate |
| SMILES | CCOc1ccccc1/N=C(\SCC)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H32N2O3S/c1-5-32-26-10-8-7-9-25(26)28-27(33-6-2)29(19-21-11-15-23(30-3)16-12-21)20-22-13-17-24(31-4)18-14-22/h7-18H,5-6,19-20H2,1-4H3/b28-27- |
| InChIKey | IZGWVOUNVGZUOA-DQSJHHFOSA-N |
| XLogP | 6.55 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|