C36H34N4O2S — CID 17256377
benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(4-phenyldiazenylphenyl)carbamimidothioate (PubChem CID 17256377) has the molecular formula C36H34N4O2S and a molecular weight of 586.76 g/mol. Its IUPAC name is benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(4-phenyldiazenylphenyl)carbamimidothioate.
| Compound Name | benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(4-phenyldiazenylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 17256377 |
| Molecular Formula | C36H34N4O2S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | benzyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(4-phenyldiazenylphenyl)carbamimidothioate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccc(/N=N/c3ccccc3)cc2)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H34N4O2S/c1-41-34-21-13-28(14-22-34)25-40(26-29-15-23-35(42-2)24-16-29)36(43-27-30-9-5-3-6-10-30)37-31-17-19-33(20-18-31)39-38-32-11-7-4-8-12-32/h3-24H,25-27H2,1-2H3/b37-36-,39-38+ |
| InChIKey | HTQYPXQBKLPBLT-ZJVCJYNNSA-N |
| XLogP | 9.74 |
| TPSA | 58.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|