C25H25F3N2O2S — CID 17256085
methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-[4-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 17256085) has the molecular formula C25H25F3N2O2S and a molecular weight of 474.55 g/mol. Its IUPAC name is methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-[4-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-[4-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 17256085 |
| Molecular Formula | C25H25F3N2O2S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-[4-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccc(C(F)(F)F)cc2)SC)cc1 |
| InChI | InChI=1S/C25H25F3N2O2S/c1-31-22-12-4-18(5-13-22)16-30(17-19-6-14-23(32-2)15-7-19)24(33-3)29-21-10-8-20(9-11-21)25(26,27)28/h4-15H,16-17H2,1-3H3/b29-24- |
| InChIKey | NHDCFVNGTGLSAO-OLFWJLLRSA-N |
| XLogP | 6.78 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|