C27H33IN2O2S — CID 17256014
methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2,4,6-trimethylphenyl)carbamimidothioate;hydroiodide (PubChem CID 17256014) has the molecular formula C27H33IN2O2S and a molecular weight of 576.54 g/mol. Its IUPAC name is methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2,4,6-trimethylphenyl)carbamimidothioate;hydroiodide.
| Compound Name | methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2,4,6-trimethylphenyl)carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 17256014 |
| Molecular Formula | C27H33IN2O2S |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | methyl N,N-bis[(4-methoxyphenyl)methyl]-N'-(2,4,6-trimethylphenyl)carbamimidothioate;hydroiodide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2c(C)cc(C)cc2C)SC)cc1.I |
| InChI | InChI=1S/C27H32N2O2S.HI/c1-19-15-20(2)26(21(3)16-19)28-27(32-6)29(17-22-7-11-24(30-4)12-8-22)18-23-9-13-25(31-5)14-10-23;/h7-16H,17-18H2,1-6H3;1H/b28-27-; |
| InChIKey | KGBXQTYXPUCGEL-LXCLTORNSA-N |
| XLogP | 7.30 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|