C30H32IN3O2S — CID 17256076
methyl N'-(4-anilinophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide (PubChem CID 17256076) has the molecular formula C30H32IN3O2S and a molecular weight of 625.58 g/mol. Its IUPAC name is methyl N'-(4-anilinophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-(4-anilinophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 17256076 |
| Molecular Formula | C30H32IN3O2S |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | methyl N'-(4-anilinophenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccc(Nc3ccccc3)cc2)SC)cc1.I |
| InChI | InChI=1S/C30H31N3O2S.HI/c1-34-28-17-9-23(10-18-28)21-33(22-24-11-19-29(35-2)20-12-24)30(36-3)32-27-15-13-26(14-16-27)31-25-7-5-4-6-8-25;/h4-20,31H,21-22H2,1-3H3;1H/b32-30-; |
| InChIKey | BYDPARZENMTGRV-GWLNUVCFSA-N |
| XLogP | 8.12 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|