C27H33IN2O4S — CID 17256190
ethyl N'-(3,5-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide (PubChem CID 17256190) has the molecular formula C27H33IN2O4S and a molecular weight of 608.54 g/mol. Its IUPAC name is ethyl N'-(3,5-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide.
| Compound Name | ethyl N'-(3,5-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 17256190 |
| Molecular Formula | C27H33IN2O4S |
| Molecular Weight | 608.54 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | ethyl N'-(3,5-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
| SMILES | CCS/C(=N\c1cc(OC)cc(OC)c1)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C27H32N2O4S.HI/c1-6-34-27(28-22-15-25(32-4)17-26(16-22)33-5)29(18-20-7-11-23(30-2)12-8-20)19-21-9-13-24(31-3)14-10-21;/h7-17H,6,18-19H2,1-5H3;1H/b28-27-; |
| InChIKey | ZHZZFYZSNLJXPF-LXCLTORNSA-N |
| XLogP | 6.78 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|