C32H35BrN2O4S — CID 17256304
benzyl N'-(2,4-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide (PubChem CID 17256304) has the molecular formula C32H35BrN2O4S and a molecular weight of 623.61 g/mol. Its IUPAC name is benzyl N'-(2,4-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide.
| Compound Name | benzyl N'-(2,4-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 17256304 |
| Molecular Formula | C32H35BrN2O4S |
| Molecular Weight | 623.61 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | benzyl N'-(2,4-dimethoxyphenyl)-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydrobromide |
| SMILES | Br.COc1ccc(CN(Cc2ccc(OC)cc2)/C(=N/c2ccc(OC)cc2OC)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O4S.BrH/c1-35-27-14-10-24(11-15-27)21-34(22-25-12-16-28(36-2)17-13-25)32(39-23-26-8-6-5-7-9-26)33-30-19-18-29(37-3)20-31(30)38-4;/h5-20H,21-23H2,1-4H3;1H/b33-32-; |
| InChIKey | LQAFJWHKZUDZDB-DYNGLPSQSA-N |
| XLogP | 7.92 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.61 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|