C26H27ClF3IN2O2S — CID 17256216
ethyl N'-[2-chloro-5-(trifluoromethyl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide (PubChem CID 17256216) has the molecular formula C26H27ClF3IN2O2S and a molecular weight of 650.93 g/mol. Its IUPAC name is ethyl N'-[2-chloro-5-(trifluoromethyl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide.
| Compound Name | ethyl N'-[2-chloro-5-(trifluoromethyl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 17256216 |
| Molecular Formula | C26H27ClF3IN2O2S |
| Molecular Weight | 650.93 g/mol |
| Exact Mass | 650.05 |
| IUPAC Name | ethyl N'-[2-chloro-5-(trifluoromethyl)phenyl]-N,N-bis[(4-methoxyphenyl)methyl]carbamimidothioate;hydroiodide |
| SMILES | CCS/C(=N\c1cc(C(F)(F)F)ccc1Cl)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C26H26ClF3N2O2S.HI/c1-4-35-25(31-24-15-20(26(28,29)30)9-14-23(24)27)32(16-18-5-10-21(33-2)11-6-18)17-19-7-12-22(34-3)13-8-19;/h5-15H,4,16-17H2,1-3H3;1H/b31-25-; |
| InChIKey | QHVGXPAAMLCKLS-WMIPQBQRSA-N |
| XLogP | 8.44 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.93 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|