C18H20F3NO — CID 162612064
4-methoxy-N-propan-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 162612064) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is 4-methoxy-N-propan-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 4-methoxy-N-propan-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 162612064 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-methoxy-N-propan-2-yl-N-[[4-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | COc1ccc(N(Cc2ccc(C(F)(F)F)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C18H20F3NO/c1-13(2)22(16-8-10-17(23-3)11-9-16)12-14-4-6-15(7-5-14)18(19,20)21/h4-11,13H,12H2,1-3H3 |
| InChIKey | KZTGOVDOTAAILO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|