C22H24F3NO2 — CID 55552365
N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 55552365) has the molecular formula C22H24F3NO2 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55552365 |
| Molecular Formula | C22H24F3NO2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(CN(C(=O)Cc2ccc(C(F)(F)F)cc2)C(C)C2CC2)cc1 |
| InChI | InChI=1S/C22H24F3NO2/c1-15(18-7-8-18)26(14-17-5-11-20(28-2)12-6-17)21(27)13-16-3-9-19(10-4-16)22(23,24)25/h3-6,9-12,15,18H,7-8,13-14H2,1-2H3 |
| InChIKey | FDJMETWLQQRASQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |