C18H20BrNO2S — CID 55762149
3-bromo-N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide (PubChem CID 55762149) has the molecular formula C18H20BrNO2S and a molecular weight of 394.33 g/mol. Its IUPAC name is 3-bromo-N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55762149 |
| Molecular Formula | C18H20BrNO2S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 3-bromo-N-(1-cyclopropylethyl)-N-[(4-methoxyphenyl)methyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2sccc2Br)C(C)C2CC2)cc1 |
| InChI | InChI=1S/C18H20BrNO2S/c1-12(14-5-6-14)20(18(21)17-16(19)9-10-23-17)11-13-3-7-15(22-2)8-4-13/h3-4,7-10,12,14H,5-6,11H2,1-2H3 |
| InChIKey | UQUPREHBRXCOCB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |