About S-(2-methoxyethyl) 4-methoxybenzenecarbothioate
S-(2-methoxyethyl) 4-methoxybenzenecarbothioate (PubChem CID 121219372) has the molecular formula C11H14O3S
and a molecular weight of 226.30 g/mol. Its IUPAC name is S-(2-methoxyethyl) 4-methoxybenzenecarbothioate.
Molecular Properties
| Compound Name | S-(2-methoxyethyl) 4-methoxybenzenecarbothioate |
| PubChem CID | 121219372 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | S-(2-methoxyethyl) 4-methoxybenzenecarbothioate |
| SMILES | COCCSC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H14O3S/c1-13-7-8-15-11(12)9-3-5-10(14-2)6-4-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | CWKVWKHYVWGVKS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methoxyethyl) 4-methoxybenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methoxyethyl) 4-methoxybenzenecarbothioate?
The IUPAC name of S-(2-methoxyethyl) 4-methoxybenzenecarbothioate (CID 121219372) is S-(2-methoxyethyl) 4-methoxybenzenecarbothioate.
What is the SMILES notation for S-(2-methoxyethyl) 4-methoxybenzenecarbothioate?
The canonical SMILES for S-(2-methoxyethyl) 4-methoxybenzenecarbothioate is COCCSC(=O)c1ccc(OC)cc1.
What is the InChIKey of S-(2-methoxyethyl) 4-methoxybenzenecarbothioate?
The InChIKey is CWKVWKHYVWGVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S/c1-13-7-8-15-11(12)9-3-5-10(14-2)6-4-9/h3-6H,7-8H2,1-2H3.
What are the key properties of S-(2-methoxyethyl) 4-methoxybenzenecarbothioate?
S-(2-methoxyethyl) 4-methoxybenzenecarbothioate has a molecular weight of 226.30 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methoxyethyl) 4-methoxybenzenecarbothioate is sourced from PubChem (CID 121219372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).