About S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate
S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate (PubChem CID 121220366) has the molecular formula C11H10O3S
and a molecular weight of 222.26 g/mol. Its IUPAC name is S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate.
Molecular Properties
| Compound Name | S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate |
| PubChem CID | 121220366 |
| Molecular Formula | C11H10O3S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate |
| SMILES | C=C(C=O)SC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H10O3S/c1-8(7-12)15-11(13)9-3-5-10(14-2)6-4-9/h3-7H,1H2,2H3 |
| InChIKey | QXEHPYUDKKGSSS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate?
The IUPAC name of S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate (CID 121220366) is S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate.
What is the SMILES notation for S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate?
The canonical SMILES for S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate is C=C(C=O)SC(=O)c1ccc(OC)cc1.
What is the InChIKey of S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate?
The InChIKey is QXEHPYUDKKGSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3S/c1-8(7-12)15-11(13)9-3-5-10(14-2)6-4-9/h3-7H,1H2,2H3.
What are the key properties of S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate?
S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate has a molecular weight of 222.26 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-oxoprop-1-en-2-yl) 4-methoxybenzenecarbothioate is sourced from PubChem (CID 121220366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).