About S-iodo 4-methoxybenzenecarbothioate
S-iodo 4-methoxybenzenecarbothioate (PubChem CID 12887177) has the molecular formula C8H7IO2S
and a molecular weight of 294.11 g/mol. Its IUPAC name is S-iodo 4-methoxybenzenecarbothioate.
Molecular Properties
| Compound Name | S-iodo 4-methoxybenzenecarbothioate |
| PubChem CID | 12887177 |
| Molecular Formula | C8H7IO2S |
| Molecular Weight | 294.11 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | S-iodo 4-methoxybenzenecarbothioate |
| SMILES | COc1ccc(C(=O)SI)cc1 |
| InChI | InChI=1S/C8H7IO2S/c1-11-7-4-2-6(3-5-7)8(10)12-9/h2-5H,1H3 |
| InChIKey | DOONIMGBOJEAHQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.11 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-iodo 4-methoxybenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-iodo 4-methoxybenzenecarbothioate?
The IUPAC name of S-iodo 4-methoxybenzenecarbothioate (CID 12887177) is S-iodo 4-methoxybenzenecarbothioate.
What is the SMILES notation for S-iodo 4-methoxybenzenecarbothioate?
The canonical SMILES for S-iodo 4-methoxybenzenecarbothioate is COc1ccc(C(=O)SI)cc1.
What is the InChIKey of S-iodo 4-methoxybenzenecarbothioate?
The InChIKey is DOONIMGBOJEAHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO2S/c1-11-7-4-2-6(3-5-7)8(10)12-9/h2-5H,1H3.
What are the key properties of S-iodo 4-methoxybenzenecarbothioate?
S-iodo 4-methoxybenzenecarbothioate has a molecular weight of 294.11 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-iodo 4-methoxybenzenecarbothioate is sourced from PubChem (CID 12887177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).