C24H22O4 — CID 13400445
2,3,3-tris(4-methoxyphenyl)prop-2-enal (PubChem CID 13400445) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2,3,3-tris(4-methoxyphenyl)prop-2-enal.
| Compound Name | 2,3,3-tris(4-methoxyphenyl)prop-2-enal |
|---|---|
| PubChem CID | 13400445 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2,3,3-tris(4-methoxyphenyl)prop-2-enal |
| SMILES | COc1ccc(C(C=O)=C(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H22O4/c1-26-20-10-4-17(5-11-20)23(16-25)24(18-6-12-21(27-2)13-7-18)19-8-14-22(28-3)15-9-19/h4-16H,1-3H3 |
| InChIKey | OYTCWLFHZDCZAW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|