C40H38N8O6 — CID 159184203
5,5-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)penta-2,4-dienal;3,3-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal (PubChem CID 159184203) has the molecular formula C40H38N8O6 and a molecular weight of 726.79 g/mol. Its IUPAC name is 5,5-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)penta-2,4-dienal;3,3-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal.
| Compound Name | 5,5-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)penta-2,4-dienal;3,3-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal |
|---|---|
| PubChem CID | 159184203 |
| Molecular Formula | C40H38N8O6 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 5,5-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)penta-2,4-dienal;3,3-bis(4-methoxyphenyl)-2-(1-methyltetrazol-5-yl)prop-2-enal |
| SMILES | COc1ccc(C(=C(C=O)c2nnnn2C)c2ccc(OC)cc2)cc1.COc1ccc(C(=CC=C(C=O)c2nnnn2C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H20N4O3.C19H18N4O3/c1-25-21(22-23-24-25)17(14-26)8-13-20(15-4-9-18(27-2)10-5-15)16-6-11-19(28-3)12-7-16;1-23-19(20-21-22-23)17(12-24)18(13-4-8-15(25-2)9-5-13)14-6-10-16(26-3)11-7-14/h4-14H,1-3H3;4-12H,1-3H3 |
| InChIKey | KNGUZOYTTFSFER-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 158.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|