C24H24N4O4 — CID 54015157
methyl 5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxo-9,9-diphenylnona-6,8-dienoate (PubChem CID 54015157) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is methyl 5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxo-9,9-diphenylnona-6,8-dienoate.
| Compound Name | methyl 5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxo-9,9-diphenylnona-6,8-dienoate |
|---|---|
| PubChem CID | 54015157 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl 5-hydroxy-8-(1-methyltetrazol-5-yl)-3-oxo-9,9-diphenylnona-6,8-dienoate |
| SMILES | COC(=O)CC(=O)CC(O)C=CC(=C(c1ccccc1)c1ccccc1)c1nnnn1C |
| InChI | InChI=1S/C24H24N4O4/c1-28-24(25-26-27-28)21(14-13-19(29)15-20(30)16-22(31)32-2)23(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14,19,29H,15-16H2,1-2H3 |
| InChIKey | KVCLUZWIPQFFEZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|